C11H26N2 — CID 91437867
butane;N,1-dimethylpiperidin-3-amine (PubChem CID 91437867) has the molecular formula C11H26N2 and a molecular weight of 186.34 g/mol. Its IUPAC name is butane;N,1-dimethylpiperidin-3-amine.
| Compound Name | butane;N,1-dimethylpiperidin-3-amine |
|---|---|
| PubChem CID | 91437867 |
| Molecular Formula | C11H26N2 |
| Molecular Weight | 186.34 g/mol |
| Exact Mass | 186.21 |
| IUPAC Name | butane;N,1-dimethylpiperidin-3-amine |
| SMILES | CCCC.CNC1CCCN(C)C1 |
| InChI | InChI=1S/C7H16N2.C4H10/c1-8-7-4-3-5-9(2)6-7;1-3-4-2/h7-8H,3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | ZFEGUDWCJHNSRA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |