C9H22N2O — CID 91223318
N,1-dimethylpiperidin-3-amine;ethanol (PubChem CID 91223318) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is N,1-dimethylpiperidin-3-amine;ethanol.
| Compound Name | N,1-dimethylpiperidin-3-amine;ethanol |
|---|---|
| PubChem CID | 91223318 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | N,1-dimethylpiperidin-3-amine;ethanol |
| SMILES | CCO.CNC1CCCN(C)C1 |
| InChI | InChI=1S/C7H16N2.C2H6O/c1-8-7-4-3-5-9(2)6-7;1-2-3/h7-8H,3-6H2,1-2H3;3H,2H2,1H3 |
| InChIKey | YOMAYLIVMLLIGW-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |