C10H22N2O — CID 91110741
N,1-dimethylpiperidin-3-amine;propan-2-one (PubChem CID 91110741) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,1-dimethylpiperidin-3-amine;propan-2-one.
| Compound Name | N,1-dimethylpiperidin-3-amine;propan-2-one |
|---|---|
| PubChem CID | 91110741 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,1-dimethylpiperidin-3-amine;propan-2-one |
| SMILES | CC(C)=O.CNC1CCCN(C)C1 |
| InChI | InChI=1S/C7H16N2.C3H6O/c1-8-7-4-3-5-9(2)6-7;1-3(2)4/h7-8H,3-6H2,1-2H3;1-2H3 |
| InChIKey | PGSLGLNBIXTSFM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |