C16H39N3 — CID 143216901
1,4-dimethylpiperazine;ethane;N-methylcyclopentanamine (PubChem CID 143216901) has the molecular formula C16H39N3 and a molecular weight of 273.51 g/mol. Its IUPAC name is 1,4-dimethylpiperazine;ethane;N-methylcyclopentanamine.
| Compound Name | 1,4-dimethylpiperazine;ethane;N-methylcyclopentanamine |
|---|---|
| PubChem CID | 143216901 |
| Molecular Formula | C16H39N3 |
| Molecular Weight | 273.51 g/mol |
| Exact Mass | 273.31 |
| IUPAC Name | 1,4-dimethylpiperazine;ethane;N-methylcyclopentanamine |
| SMILES | CC.CC.CN1CCN(C)CC1.CNC1CCCC1 |
| InChI | InChI=1S/C6H14N2.C6H13N.2C2H6/c1-7-3-5-8(2)6-4-7;1-7-6-4-2-3-5-6;2*1-2/h3-6H2,1-2H3;6-7H,2-5H2,1H3;2*1-2H3 |
| InChIKey | JTKBKNIKLPWYLL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |