About sodium;cyanoboranuide;N-methylcyclohexanamine
sodium;cyanoboranuide;N-methylcyclohexanamine (PubChem CID 175322273) has the molecular formula C8H18BN2Na
and a molecular weight of 176.05 g/mol. Its IUPAC name is sodium;cyanoboranuide;N-methylcyclohexanamine.
Molecular Properties
| Compound Name | sodium;cyanoboranuide;N-methylcyclohexanamine |
| PubChem CID | 175322273 |
| Molecular Formula | C8H18BN2Na |
| Molecular Weight | 176.05 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | sodium;cyanoboranuide;N-methylcyclohexanamine |
| SMILES | CNC1CCCCC1.[BH3-]C#N.[Na+] |
| InChI | InChI=1S/C7H15N.CH3BN.Na/c1-8-7-5-3-2-4-6-7;2-1-3;/h7-8H,2-6H2,1H3;2H3;/q;-1;+1 |
| InChIKey | ABCIUYMOSLXOCM-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.05 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;cyanoboranuide;N-methylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;cyanoboranuide;N-methylcyclohexanamine?
The IUPAC name of sodium;cyanoboranuide;N-methylcyclohexanamine (CID 175322273) is sodium;cyanoboranuide;N-methylcyclohexanamine.
What is the SMILES notation for sodium;cyanoboranuide;N-methylcyclohexanamine?
The canonical SMILES for sodium;cyanoboranuide;N-methylcyclohexanamine is CNC1CCCCC1.[BH3-]C#N.[Na+].
What is the InChIKey of sodium;cyanoboranuide;N-methylcyclohexanamine?
The InChIKey is ABCIUYMOSLXOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.CH3BN.Na/c1-8-7-5-3-2-4-6-7;2-1-3;/h7-8H,2-6H2,1H3;2H3;/q;-1;+1.
What are the key properties of sodium;cyanoboranuide;N-methylcyclohexanamine?
sodium;cyanoboranuide;N-methylcyclohexanamine has a molecular weight of 176.05 g/mol, XLogP of -2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;cyanoboranuide;N-methylcyclohexanamine is sourced from PubChem (CID 175322273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).