C14H10N2 — CID 123544525
2,9-dimethylidene-1,10-phenanthroline (PubChem CID 123544525) has the molecular formula C14H10N2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 2,9-dimethylidene-1,10-phenanthroline.
| Compound Name | 2,9-dimethylidene-1,10-phenanthroline |
|---|---|
| PubChem CID | 123544525 |
| Molecular Formula | C14H10N2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2,9-dimethylidene-1,10-phenanthroline |
| SMILES | C=c1ccc2ccc3ccc(=C)nc3c2n1 |
| InChI | InChI=1S/C14H10N2/c1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9/h3-8H,1-2H2 |
| InChIKey | SBXBARSOUBQDSL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|