About (6-fluoro-2-pyridinyl) thiohypochlorite
(6-fluoro-2-pyridinyl) thiohypochlorite (PubChem CID 123544589) has the molecular formula C5H3ClFNS
and a molecular weight of 163.60 g/mol. Its IUPAC name is (6-fluoro-2-pyridinyl) thiohypochlorite.
Molecular Properties
| Compound Name | (6-fluoro-2-pyridinyl) thiohypochlorite |
| PubChem CID | 123544589 |
| Molecular Formula | C5H3ClFNS |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 162.97 |
| IUPAC Name | (6-fluoro-2-pyridinyl) thiohypochlorite |
| SMILES | Fc1cccc(SCl)n1 |
| InChI | InChI=1S/C5H3ClFNS/c6-9-5-3-1-2-4(7)8-5/h1-3H |
| InChIKey | MHSJJFGTIMJQHL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (6-fluoro-2-pyridinyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2-pyridinyl) thiohypochlorite?
The IUPAC name of (6-fluoro-2-pyridinyl) thiohypochlorite (CID 123544589) is (6-fluoro-2-pyridinyl) thiohypochlorite.
What is the SMILES notation for (6-fluoro-2-pyridinyl) thiohypochlorite?
The canonical SMILES for (6-fluoro-2-pyridinyl) thiohypochlorite is Fc1cccc(SCl)n1.
What is the InChIKey of (6-fluoro-2-pyridinyl) thiohypochlorite?
The InChIKey is MHSJJFGTIMJQHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3ClFNS/c6-9-5-3-1-2-4(7)8-5/h1-3H.
What are the key properties of (6-fluoro-2-pyridinyl) thiohypochlorite?
(6-fluoro-2-pyridinyl) thiohypochlorite has a molecular weight of 163.60 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2-pyridinyl) thiohypochlorite is sourced from PubChem (CID 123544589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).