About CID 159769394
CID 159769394 (PubChem CID 159769394) has the molecular formula C5H5BF2NO2
and a molecular weight of 159.91 g/mol.
Molecular Properties
| Compound Name | CID 159769394 |
| PubChem CID | 159769394 |
| Molecular Formula | C5H5BF2NO2 |
| Molecular Weight | 159.91 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | — |
| SMILES | Fc1cccc(F)n1.O[B]O |
| InChI | InChI=1S/C5H3F2N.BH2O2/c6-4-2-1-3-5(7)8-4;2-1-3/h1-3H;2-3H |
| InChIKey | WYRGKTUXGUEEEH-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.91 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159769394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159769394?
The IUPAC name of CID 159769394 (CID 159769394) is not available.
What is the SMILES notation for CID 159769394?
The canonical SMILES for CID 159769394 is Fc1cccc(F)n1.O[B]O.
What is the InChIKey of CID 159769394?
The InChIKey is WYRGKTUXGUEEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F2N.BH2O2/c6-4-2-1-3-5(7)8-4;2-1-3/h1-3H;2-3H.
What are the key properties of CID 159769394?
CID 159769394 has a molecular weight of 159.91 g/mol, XLogP of -0.14, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159769394 is sourced from PubChem (CID 159769394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).