C10H6F4N2 — CID 174955945
2,3-difluoropyridine;2,6-difluoropyridine (PubChem CID 174955945) has the molecular formula C10H6F4N2 and a molecular weight of 230.16 g/mol. Its IUPAC name is 2,3-difluoropyridine;2,6-difluoropyridine.
| Compound Name | 2,3-difluoropyridine;2,6-difluoropyridine |
|---|---|
| PubChem CID | 174955945 |
| Molecular Formula | C10H6F4N2 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2,3-difluoropyridine;2,6-difluoropyridine |
| SMILES | Fc1cccc(F)n1.Fc1cccnc1F |
| InChI | InChI=1S/2C5H3F2N/c6-4-2-1-3-8-5(4)7;6-4-2-1-3-5(7)8-4/h2*1-3H |
| InChIKey | BJJFUPKYMYLKDG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|