About 2,3-difluoropyridine;2,6-difluoropyridine
2,3-difluoropyridine;2,6-difluoropyridine (PubChem CID 174955945) has the molecular formula C10H6F4N2
and a molecular weight of 230.16 g/mol. Its IUPAC name is 2,3-difluoropyridine;2,6-difluoropyridine.
Molecular Properties
| Compound Name | 2,3-difluoropyridine;2,6-difluoropyridine |
| PubChem CID | 174955945 |
| Molecular Formula | C10H6F4N2 |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 2,3-difluoropyridine;2,6-difluoropyridine |
| SMILES | Fc1cccc(F)n1.Fc1cccnc1F |
| InChI | InChI=1S/2C5H3F2N/c6-4-2-1-3-8-5(4)7;6-4-2-1-3-5(7)8-4/h2*1-3H |
| InChIKey | BJJFUPKYMYLKDG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2,3-difluoropyridine;2,6-difluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoropyridine;2,6-difluoropyridine?
The IUPAC name of 2,3-difluoropyridine;2,6-difluoropyridine (CID 174955945) is 2,3-difluoropyridine;2,6-difluoropyridine.
What is the SMILES notation for 2,3-difluoropyridine;2,6-difluoropyridine?
The canonical SMILES for 2,3-difluoropyridine;2,6-difluoropyridine is Fc1cccc(F)n1.Fc1cccnc1F.
What is the InChIKey of 2,3-difluoropyridine;2,6-difluoropyridine?
The InChIKey is BJJFUPKYMYLKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H3F2N/c6-4-2-1-3-8-5(4)7;6-4-2-1-3-5(7)8-4/h2*1-3H.
What are the key properties of 2,3-difluoropyridine;2,6-difluoropyridine?
2,3-difluoropyridine;2,6-difluoropyridine has a molecular weight of 230.16 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoropyridine;2,6-difluoropyridine is sourced from PubChem (CID 174955945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).