C13H15ClF2N2 — CID 160889708
(4-chlorophenyl)methanamine;2,6-difluoropyridine;methane (PubChem CID 160889708) has the molecular formula C13H15ClF2N2 and a molecular weight of 272.73 g/mol. Its IUPAC name is (4-chlorophenyl)methanamine;2,6-difluoropyridine;methane.
| Compound Name | (4-chlorophenyl)methanamine;2,6-difluoropyridine;methane |
|---|---|
| PubChem CID | 160889708 |
| Molecular Formula | C13H15ClF2N2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | (4-chlorophenyl)methanamine;2,6-difluoropyridine;methane |
| SMILES | C.Fc1cccc(F)n1.NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C7H8ClN.C5H3F2N.CH4/c8-7-3-1-6(5-9)2-4-7;6-4-2-1-3-5(7)8-4;/h1-4H,5,9H2;1-3H;1H4 |
| InChIKey | SOCIVZSDFSJHGI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|