About 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine
1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine (PubChem CID 123545131) has the molecular formula C9H15N2+
and a molecular weight of 151.23 g/mol. Its IUPAC name is 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine.
Molecular Properties
| Compound Name | 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine |
| PubChem CID | 123545131 |
| Molecular Formula | C9H15N2+ |
| Molecular Weight | 151.23 g/mol |
| Exact Mass | 151.12 |
| IUPAC Name | 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine |
| SMILES | N[N+]1(CC2=CC=CCC2)CC1 |
| InChI | InChI=1S/C9H15N2/c10-11(6-7-11)8-9-4-2-1-3-5-9/h1-2,4H,3,5-8,10H2/q+1 |
| InChIKey | JCVMPTGDFBPNSF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine?
The IUPAC name of 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine (CID 123545131) is 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine.
What is the SMILES notation for 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine?
The canonical SMILES for 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine is N[N+]1(CC2=CC=CCC2)CC1.
What is the InChIKey of 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine?
The InChIKey is JCVMPTGDFBPNSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N2/c10-11(6-7-11)8-9-4-2-1-3-5-9/h1-2,4H,3,5-8,10H2/q+1.
What are the key properties of 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine?
1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine has a molecular weight of 151.23 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexa-1,3-dien-1-ylmethyl)aziridin-1-ium-1-amine is sourced from PubChem (CID 123545131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).