C9H14N2 — CID 143656783
4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-amine (PubChem CID 143656783) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-amine.
| Compound Name | 4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-amine |
|---|---|
| PubChem CID | 143656783 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 4,5-bis(ethenyl)-3,6-dihydro-2H-pyridin-1-amine |
| SMILES | C=CC1=C(C=C)CN(N)CC1 |
| InChI | InChI=1S/C9H14N2/c1-3-8-5-6-11(10)7-9(8)4-2/h3-4H,1-2,5-7,10H2 |
| InChIKey | QBZLHVBABXZISP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|