C21H27ClFN2O4+ — CID 123545757
4-[6-chloro-2-fluoro-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoyl]penta-2,4-dienylidene-hydroxy-methylazanium (PubChem CID 123545757) has the molecular formula C21H27ClFN2O4+ and a molecular weight of 425.91 g/mol. Its IUPAC name is 4-[6-chloro-2-fluoro-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoyl]penta-2,4-dienylidene-hydroxy-methylazanium.
| Compound Name | 4-[6-chloro-2-fluoro-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoyl]penta-2,4-dienylidene-hydroxy-methylazanium |
|---|---|
| PubChem CID | 123545757 |
| Molecular Formula | C21H27ClFN2O4+ |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 4-[6-chloro-2-fluoro-3-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoyl]penta-2,4-dienylidene-hydroxy-methylazanium |
| SMILES | C=C(C=CC=[N+](C)O)C(=O)c1c(Cl)ccc(C(CC)NC(=O)OC(C)(C)C)c1F |
| InChI | InChI=1S/C21H26ClFN2O4/c1-7-16(24-20(27)29-21(3,4)5)14-10-11-15(22)17(18(14)23)19(26)13(2)9-8-12-25(6)28/h8-12,16H,2,7H2,1,3-6H3,(H-,24,27,28)/p+1 |
| InChIKey | MBECXXCZWLYNAH-UHFFFAOYSA-O |
| XLogP | 4.85 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|