C20H22ClF2NO3 — CID 141369791
tert-butyl N-[(1R)-1-[4-chloro-2-fluoro-3-(4-fluorophenoxy)phenyl]propyl]carbamate (PubChem CID 141369791) has the molecular formula C20H22ClF2NO3 and a molecular weight of 397.85 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[4-chloro-2-fluoro-3-(4-fluorophenoxy)phenyl]propyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[4-chloro-2-fluoro-3-(4-fluorophenoxy)phenyl]propyl]carbamate |
|---|---|
| PubChem CID | 141369791 |
| Molecular Formula | C20H22ClF2NO3 |
| Molecular Weight | 397.85 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | tert-butyl N-[(1R)-1-[4-chloro-2-fluoro-3-(4-fluorophenoxy)phenyl]propyl]carbamate |
| SMILES | CC[C@@H](NC(=O)OC(C)(C)C)c1ccc(Cl)c(Oc2ccc(F)cc2)c1F |
| InChI | InChI=1S/C20H22ClF2NO3/c1-5-16(24-19(25)27-20(2,3)4)14-10-11-15(21)18(17(14)23)26-13-8-6-12(22)7-9-13/h6-11,16H,5H2,1-4H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | IYSURJMOJFOENZ-MRXNPFEDSA-N |
| XLogP | 6.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.85 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |