C20H25ClFN3O2 — CID 140655371
N-(2-aminoethyl)-2-[[(1R)-1-(4-chloro-2-fluoro-3-phenoxyphenyl)propyl]amino]propanamide (PubChem CID 140655371) has the molecular formula C20H25ClFN3O2 and a molecular weight of 393.89 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[(1R)-1-(4-chloro-2-fluoro-3-phenoxyphenyl)propyl]amino]propanamide.
| Compound Name | N-(2-aminoethyl)-2-[[(1R)-1-(4-chloro-2-fluoro-3-phenoxyphenyl)propyl]amino]propanamide |
|---|---|
| PubChem CID | 140655371 |
| Molecular Formula | C20H25ClFN3O2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-(2-aminoethyl)-2-[[(1R)-1-(4-chloro-2-fluoro-3-phenoxyphenyl)propyl]amino]propanamide |
| SMILES | CC[C@@H](NC(C)C(=O)NCCN)c1ccc(Cl)c(Oc2ccccc2)c1F |
| InChI | InChI=1S/C20H25ClFN3O2/c1-3-17(25-13(2)20(26)24-12-11-23)15-9-10-16(21)19(18(15)22)27-14-7-5-4-6-8-14/h4-10,13,17,25H,3,11-12,23H2,1-2H3,(H,24,26)/t13?,17-/m1/s1 |
| InChIKey | WLOXFIPWWZOXOD-LRHAYUFXSA-N |
| XLogP | 3.78 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |