C20H24ClFN2O3S — CID 131741265
(R)-N-[(1R)-1-[4-chloro-2-fluoro-3-[4-(hydroxyiminomethyl)phenoxy]phenyl]propyl]-2-methylpropane-2-sulfinamide (PubChem CID 131741265) has the molecular formula C20H24ClFN2O3S and a molecular weight of 426.94 g/mol. Its IUPAC name is (R)-N-[(1R)-1-[4-chloro-2-fluoro-3-[4-(hydroxyiminomethyl)phenoxy]phenyl]propyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1R)-1-[4-chloro-2-fluoro-3-[4-(hydroxyiminomethyl)phenoxy]phenyl]propyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 131741265 |
| Molecular Formula | C20H24ClFN2O3S |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (R)-N-[(1R)-1-[4-chloro-2-fluoro-3-[4-(hydroxyiminomethyl)phenoxy]phenyl]propyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC[C@@H](N[S@](=O)C(C)(C)C)c1ccc(Cl)c(Oc2ccc(C=NO)cc2)c1F |
| InChI | InChI=1S/C20H24ClFN2O3S/c1-5-17(24-28(26)20(2,3)4)15-10-11-16(21)19(18(15)22)27-14-8-6-13(7-9-14)12-23-25/h6-12,17,24-25H,5H2,1-4H3/t17-,28-/m1/s1 |
| InChIKey | WQCQFWABFOPCHF-JYRCXFKTSA-N |
| XLogP | 5.58 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|