C20H25ClFN3O2 — CID 71556731
(3R)-3-[[(1R)-1-[3-(4-amino-3-methylphenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide (PubChem CID 71556731) has the molecular formula C20H25ClFN3O2 and a molecular weight of 393.89 g/mol. Its IUPAC name is (3R)-3-[[(1R)-1-[3-(4-amino-3-methylphenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide.
| Compound Name | (3R)-3-[[(1R)-1-[3-(4-amino-3-methylphenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide |
|---|---|
| PubChem CID | 71556731 |
| Molecular Formula | C20H25ClFN3O2 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | (3R)-3-[[(1R)-1-[3-(4-amino-3-methylphenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide |
| SMILES | CC[C@@H](N[C@H](C)CC(N)=O)c1ccc(Cl)c(Oc2ccc(N)c(C)c2)c1F |
| InChI | InChI=1S/C20H25ClFN3O2/c1-4-17(25-12(3)10-18(24)26)14-6-7-15(21)20(19(14)22)27-13-5-8-16(23)11(2)9-13/h5-9,12,17,25H,4,10,23H2,1-3H3,(H2,24,26)/t12-,17-/m1/s1 |
| InChIKey | JLSPYOFBMDYSDY-SJKOYZFVSA-N |
| XLogP | 4.47 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|