C19H24Cl4FN3O2 — CID 140655296
(3S)-3-[[(1R)-1-[3-(4-amino-3-chlorophenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide;dihydrochloride (PubChem CID 140655296) has the molecular formula C19H24Cl4FN3O2 and a molecular weight of 487.23 g/mol. Its IUPAC name is (3S)-3-[[(1R)-1-[3-(4-amino-3-chlorophenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide;dihydrochloride.
| Compound Name | (3S)-3-[[(1R)-1-[3-(4-amino-3-chlorophenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 140655296 |
| Molecular Formula | C19H24Cl4FN3O2 |
| Molecular Weight | 487.23 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | (3S)-3-[[(1R)-1-[3-(4-amino-3-chlorophenoxy)-4-chloro-2-fluorophenyl]propyl]amino]butanamide;dihydrochloride |
| SMILES | CC[C@@H](N[C@@H](C)CC(N)=O)c1ccc(Cl)c(Oc2ccc(N)c(Cl)c2)c1F.Cl.Cl |
| InChI | InChI=1S/C19H22Cl2FN3O2.2ClH/c1-3-16(25-10(2)8-17(24)26)12-5-6-13(20)19(18(12)22)27-11-4-7-15(23)14(21)9-11;;/h4-7,9-10,16,25H,3,8,23H2,1-2H3,(H2,24,26);2*1H/t10-,16+;;/m0../s1 |
| InChIKey | CBTLGEMNGRJELU-AUESXBFESA-N |
| XLogP | 5.66 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.23 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|