C23H30ClFN4O2 — CID 161391780
(3S)-3-[[(1R)-1-[3-(6-aminopyridine-3-carbonyl)-4-chloro-2-fluorophenyl]propyl]amino]-N-butylbutanamide (PubChem CID 161391780) has the molecular formula C23H30ClFN4O2 and a molecular weight of 448.97 g/mol. Its IUPAC name is (3S)-3-[[(1R)-1-[3-(6-aminopyridine-3-carbonyl)-4-chloro-2-fluorophenyl]propyl]amino]-N-butylbutanamide.
| Compound Name | (3S)-3-[[(1R)-1-[3-(6-aminopyridine-3-carbonyl)-4-chloro-2-fluorophenyl]propyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 161391780 |
| Molecular Formula | C23H30ClFN4O2 |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (3S)-3-[[(1R)-1-[3-(6-aminopyridine-3-carbonyl)-4-chloro-2-fluorophenyl]propyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C[C@H](C)N[C@H](CC)c1ccc(Cl)c(C(=O)c2ccc(N)nc2)c1F |
| InChI | InChI=1S/C23H30ClFN4O2/c1-4-6-11-27-20(30)12-14(3)29-18(5-2)16-8-9-17(24)21(22(16)25)23(31)15-7-10-19(26)28-13-15/h7-10,13-14,18,29H,4-6,11-12H2,1-3H3,(H2,26,28)(H,27,30)/t14-,18+/m0/s1 |
| InChIKey | MLXPQFRBWVEBLO-KBXCAEBGSA-N |
| XLogP | 4.42 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|