C19H22F2N2O3 — CID 131741216
tert-butyl N-[2-amino-1-(2,4-difluoro-3-phenoxyphenyl)ethyl]carbamate (PubChem CID 131741216) has the molecular formula C19H22F2N2O3 and a molecular weight of 364.39 g/mol. Its IUPAC name is tert-butyl N-[2-amino-1-(2,4-difluoro-3-phenoxyphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-amino-1-(2,4-difluoro-3-phenoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 131741216 |
| Molecular Formula | C19H22F2N2O3 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | tert-butyl N-[2-amino-1-(2,4-difluoro-3-phenoxyphenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CN)c1ccc(F)c(Oc2ccccc2)c1F |
| InChI | InChI=1S/C19H22F2N2O3/c1-19(2,3)26-18(24)23-15(11-22)13-9-10-14(20)17(16(13)21)25-12-7-5-4-6-8-12/h4-10,15H,11,22H2,1-3H3,(H,23,24) |
| InChIKey | HNAMWRPNUHEXAR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |