C21H18ClFN4O2 — CID 123546827
3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-5-fluoro-7-(3-methylpiperazin-1-yl)chromen-2-one (PubChem CID 123546827) has the molecular formula C21H18ClFN4O2 and a molecular weight of 412.85 g/mol. Its IUPAC name is 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-5-fluoro-7-(3-methylpiperazin-1-yl)chromen-2-one.
| Compound Name | 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-5-fluoro-7-(3-methylpiperazin-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 123546827 |
| Molecular Formula | C21H18ClFN4O2 |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-(8-chloroimidazo[1,2-a]pyridin-2-yl)-5-fluoro-7-(3-methylpiperazin-1-yl)chromen-2-one |
| SMILES | CC1CN(c2cc(F)c3cc(-c4cn5cccc(Cl)c5n4)c(=O)oc3c2)CCN1 |
| InChI | InChI=1S/C21H18ClFN4O2/c1-12-10-26(6-4-24-12)13-7-17(23)14-9-15(21(28)29-19(14)8-13)18-11-27-5-2-3-16(22)20(27)25-18/h2-3,5,7-9,11-12,24H,4,6,10H2,1H3 |
| InChIKey | HFTTXUKJXNOKGT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|