About N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine
N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine (PubChem CID 123549216) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine.
Molecular Properties
| Compound Name | N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine |
| PubChem CID | 123549216 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine |
| SMILES | C=NC(=CC(=C)OC)C1CCNCC1 |
| InChI | InChI=1S/C11H18N2O/c1-9(14-3)8-11(12-2)10-4-6-13-7-5-10/h8,10,13H,1-2,4-7H2,3H3 |
| InChIKey | SZCYCLXDZWEYKX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine?
The IUPAC name of N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine (CID 123549216) is N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine.
What is the SMILES notation for N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine?
The canonical SMILES for N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine is C=NC(=CC(=C)OC)C1CCNCC1.
What is the InChIKey of N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine?
The InChIKey is SZCYCLXDZWEYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-9(14-3)8-11(12-2)10-4-6-13-7-5-10/h8,10,13H,1-2,4-7H2,3H3.
What are the key properties of N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine?
N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine has a molecular weight of 194.28 g/mol, XLogP of 1.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methoxy-1-piperidin-4-ylbuta-1,3-dienyl)methanimine is sourced from PubChem (CID 123549216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).