C10H20N4O — CID 167157907
(3Z)-2-methoxy-4-piperidin-4-ylbuta-1,3-diene-1,1,4-triamine (PubChem CID 167157907) has the molecular formula C10H20N4O and a molecular weight of 212.30 g/mol. Its IUPAC name is (3Z)-2-methoxy-4-piperidin-4-ylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-2-methoxy-4-piperidin-4-ylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 167157907 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (3Z)-2-methoxy-4-piperidin-4-ylbuta-1,3-diene-1,1,4-triamine |
| SMILES | COC(/C=C(\N)C1CCNCC1)=C(N)N |
| InChI | InChI=1S/C10H20N4O/c1-15-9(10(12)13)6-8(11)7-2-4-14-5-3-7/h6-7,14H,2-5,11-13H2,1H3/b8-6- |
| InChIKey | QGJIFDLSJMPSIZ-VURMDHGXSA-N |
| XLogP | -0.44 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|