C13H21NO — CID 143276795
4-[(2Z,4Z)-3-methoxyhepta-2,4,6-trien-2-yl]piperidine (PubChem CID 143276795) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is 4-[(2Z,4Z)-3-methoxyhepta-2,4,6-trien-2-yl]piperidine.
| Compound Name | 4-[(2Z,4Z)-3-methoxyhepta-2,4,6-trien-2-yl]piperidine |
|---|---|
| PubChem CID | 143276795 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | 4-[(2Z,4Z)-3-methoxyhepta-2,4,6-trien-2-yl]piperidine |
| SMILES | C=C/C=C\C(OC)=C(/C)C1CCNCC1 |
| InChI | InChI=1S/C13H21NO/c1-4-5-6-13(15-3)11(2)12-7-9-14-10-8-12/h4-6,12,14H,1,7-10H2,2-3H3/b6-5-,13-11- |
| InChIKey | AOVIEYCNXUDPDF-VNWVSWPHSA-N |
| XLogP | 2.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|