C15H19NO2 — CID 67620970
4-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)piperidine (PubChem CID 67620970) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)piperidine.
| Compound Name | 4-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)piperidine |
|---|---|
| PubChem CID | 67620970 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-(5-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)piperidine |
| SMILES | C1=CCCC(C2=COC(C3CCNCC3)=CO2)=C1 |
| InChI | InChI=1S/C15H19NO2/c1-2-4-12(5-3-1)14-10-18-15(11-17-14)13-6-8-16-9-7-13/h1-2,4,10-11,13,16H,3,5-9H2 |
| InChIKey | DKILLIGSSVOSME-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |