C21H15ClN8O — CID 123549330
3-chloro-7-[1-[(5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]-6-phenylimidazo[1,2-c]pyrimidin-5-one (PubChem CID 123549330) has the molecular formula C21H15ClN8O and a molecular weight of 430.86 g/mol. Its IUPAC name is 3-chloro-7-[1-[(5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]-6-phenylimidazo[1,2-c]pyrimidin-5-one.
| Compound Name | 3-chloro-7-[1-[(5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]-6-phenylimidazo[1,2-c]pyrimidin-5-one |
|---|---|
| PubChem CID | 123549330 |
| Molecular Formula | C21H15ClN8O |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 3-chloro-7-[1-[(5-isocyano-7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]ethyl]-6-phenylimidazo[1,2-c]pyrimidin-5-one |
| SMILES | [C-]#[N+]c1c[nH]c2ncnc(NC(C)c3cc4ncc(Cl)n4c(=O)n3-c3ccccc3)c12 |
| InChI | InChI=1S/C21H15ClN8O/c1-12(28-20-18-14(23-2)9-25-19(18)26-11-27-20)15-8-17-24-10-16(22)30(17)21(31)29(15)13-6-4-3-5-7-13/h3-12H,1H3,(H2,25,26,27,28) |
| InChIKey | UWRZMHSDSKKIGB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|