C27H22N8O2 — CID 123260550
3-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one (PubChem CID 123260550) has the molecular formula C27H22N8O2 and a molecular weight of 490.53 g/mol. Its IUPAC name is 3-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 123260550 |
| Molecular Formula | C27H22N8O2 |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-[(1S)-1-[(6-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(2-methoxypyrimidin-5-yl)-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1c(N)ncnc1N[C@@H](C)c1cc2cccc(-c3cnc(OC)nc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C27H22N8O2/c1-16(34-25-23(29-2)24(28)32-15-33-25)21-12-17-8-7-11-20(18-13-30-27(37-3)31-14-18)22(17)26(36)35(21)19-9-5-4-6-10-19/h4-16H,1,3H3,(H3,28,32,33,34)/t16-/m0/s1 |
| InChIKey | LDGDAIPXNHNUFO-INIZCTEOSA-N |
| XLogP | 4.55 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|