C30H26N6O — CID 146911121
3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(3-ethylphenyl)-2-phenylisoquinolin-1-one (PubChem CID 146911121) has the molecular formula C30H26N6O and a molecular weight of 486.58 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(3-ethylphenyl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(3-ethylphenyl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 146911121 |
| Molecular Formula | C30H26N6O |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-(3-ethylphenyl)-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(-c3cccc(CC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C30H26N6O/c1-4-20-10-8-11-21(16-20)24-15-9-12-22-17-26(19(2)34-28-25(32-3)18-33-30(31)35-28)36(29(37)27(22)24)23-13-6-5-7-14-23/h5-19H,4H2,1-2H3,(H3,31,33,34,35)/t19-/m0/s1 |
| InChIKey | ABIAJZRWNIAPDL-IBGZPJMESA-N |
| XLogP | 6.32 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|