C29H25N7O — CID 140786753
3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[3-(methylamino)phenyl]-2-phenylisoquinolin-1-one (PubChem CID 140786753) has the molecular formula C29H25N7O and a molecular weight of 487.57 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[3-(methylamino)phenyl]-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[3-(methylamino)phenyl]-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 140786753 |
| Molecular Formula | C29H25N7O |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-8-[3-(methylamino)phenyl]-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(-c3cccc(NC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H25N7O/c1-18(34-27-24(32-3)17-33-29(30)35-27)25-16-20-10-8-14-23(19-9-7-11-21(15-19)31-2)26(20)28(37)36(25)22-12-5-4-6-13-22/h4-18,31H,1-2H3,(H3,30,33,34,35)/t18-/m0/s1 |
| InChIKey | STNIRAKCXKVFSI-SFHVURJKSA-N |
| XLogP | 5.80 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|