C27H21N7O — CID 162206066
3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-2-phenyl-8-pyridazin-4-ylisoquinolin-1-one (PubChem CID 162206066) has the molecular formula C27H21N7O and a molecular weight of 459.51 g/mol. Its IUPAC name is 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-2-phenyl-8-pyridazin-4-ylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-2-phenyl-8-pyridazin-4-ylisoquinolin-1-one |
|---|---|
| PubChem CID | 162206066 |
| Molecular Formula | C27H21N7O |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-2-phenyl-8-pyridazin-4-ylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(C)nc1N[C@@H](C)c1cc2cccc(-c3ccnnc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C27H21N7O/c1-17(32-26-23(28-3)16-29-18(2)33-26)24-14-19-8-7-11-22(20-12-13-30-31-15-20)25(19)27(35)34(24)21-9-5-4-6-10-21/h4-17H,1-2H3,(H,29,32,33)/t17-/m0/s1 |
| InChIKey | HIDJRJLUBYLKIS-KRWDZBQOSA-N |
| XLogP | 5.27 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|