C29H24N6O3S — CID 157374645
3-[3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]benzenesulfonamide (PubChem CID 157374645) has the molecular formula C29H24N6O3S and a molecular weight of 536.62 g/mol. Its IUPAC name is 3-[3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]benzenesulfonamide.
| Compound Name | 3-[3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 157374645 |
| Molecular Formula | C29H24N6O3S |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 3-[3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]benzenesulfonamide |
| SMILES | [C-]#[N+]c1cnc(C)nc1N[C@@H](C)c1cc2cccc(-c3cccc(S(N)(=O)=O)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H24N6O3S/c1-18(33-28-25(31-3)17-32-19(2)34-28)26-16-21-10-8-14-24(20-9-7-13-23(15-20)39(30,37)38)27(21)29(36)35(26)22-11-5-4-6-12-22/h4-18H,1-2H3,(H2,30,37,38)(H,32,33,34)/t18-/m0/s1 |
| InChIKey | LUAAEHCFSVRTOG-SFHVURJKSA-N |
| XLogP | 5.13 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|