C29H25N7O3S — CID 123563655
N-[4-[3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]phenyl]methanesulfonamide (PubChem CID 123563655) has the molecular formula C29H25N7O3S and a molecular weight of 551.63 g/mol. Its IUPAC name is N-[4-[3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 123563655 |
| Molecular Formula | C29H25N7O3S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | N-[4-[3-[(1S)-1-[(2-amino-5-isocyanopyrimidin-4-yl)amino]ethyl]-1-oxo-2-phenylisoquinolin-8-yl]phenyl]methanesulfonamide |
| SMILES | [C-]#[N+]c1cnc(N)nc1N[C@@H](C)c1cc2cccc(-c3ccc(NS(C)(=O)=O)cc3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H25N7O3S/c1-18(33-27-24(31-2)17-32-29(30)34-27)25-16-20-8-7-11-23(19-12-14-21(15-13-19)35-40(3,38)39)26(20)28(37)36(25)22-9-5-4-6-10-22/h4-18,35H,1,3H3,(H3,30,32,33,34)/t18-/m0/s1 |
| InChIKey | OLIQOQRFRGREPD-SFHVURJKSA-N |
| XLogP | 5.13 |
| TPSA | 136.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|