C30H22N6O — CID 158232041
3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(3-isocyanophenyl)-2-phenylisoquinolin-1-one (PubChem CID 158232041) has the molecular formula C30H22N6O and a molecular weight of 482.55 g/mol. Its IUPAC name is 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(3-isocyanophenyl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(3-isocyanophenyl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 158232041 |
| Molecular Formula | C30H22N6O |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(3-isocyanophenyl)-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cccc(-c2cccc3cc([C@H](C)Nc4nc(C)ncc4[N+]#[C-])n(-c4ccccc4)c(=O)c23)c1 |
| InChI | InChI=1S/C30H22N6O/c1-19(34-29-26(32-4)18-33-20(2)35-29)27-17-22-11-9-15-25(21-10-8-12-23(16-21)31-3)28(22)30(37)36(27)24-13-6-5-7-14-24/h5-19H,1-2H3,(H,33,34,35)/t19-/m0/s1 |
| InChIKey | LATPFMVTCAXCON-IBGZPJMESA-N |
| XLogP | 7.03 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|