C28H23N7O2 — CID 158083838
3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(6-methoxypyridazin-4-yl)-2-phenylisoquinolin-1-one (PubChem CID 158083838) has the molecular formula C28H23N7O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(6-methoxypyridazin-4-yl)-2-phenylisoquinolin-1-one.
| Compound Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(6-methoxypyridazin-4-yl)-2-phenylisoquinolin-1-one |
|---|---|
| PubChem CID | 158083838 |
| Molecular Formula | C28H23N7O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 3-[(1S)-1-[(5-isocyano-2-methylpyrimidin-4-yl)amino]ethyl]-8-(6-methoxypyridazin-4-yl)-2-phenylisoquinolin-1-one |
| SMILES | [C-]#[N+]c1cnc(C)nc1N[C@@H](C)c1cc2cccc(-c3cnnc(OC)c3)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H23N7O2/c1-17(32-27-23(29-3)16-30-18(2)33-27)24-13-19-9-8-12-22(20-14-25(37-4)34-31-15-20)26(19)28(36)35(24)21-10-6-5-7-11-21/h5-17H,1-2,4H3,(H,30,32,33)/t17-/m0/s1 |
| InChIKey | RSHOLTZSZAMVHA-KRWDZBQOSA-N |
| XLogP | 5.28 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|