C20H26N4O2 — CID 123549335
(2-ethoxyphenyl)-(2,7,8,9-tetramethyl-5,5a-dihydro-3H-pyrimido[1,2-b][1,2,5]triazepin-4-yl)methanone (PubChem CID 123549335) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is (2-ethoxyphenyl)-(2,7,8,9-tetramethyl-5,5a-dihydro-3H-pyrimido[1,2-b][1,2,5]triazepin-4-yl)methanone.
| Compound Name | (2-ethoxyphenyl)-(2,7,8,9-tetramethyl-5,5a-dihydro-3H-pyrimido[1,2-b][1,2,5]triazepin-4-yl)methanone |
|---|---|
| PubChem CID | 123549335 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (2-ethoxyphenyl)-(2,7,8,9-tetramethyl-5,5a-dihydro-3H-pyrimido[1,2-b][1,2,5]triazepin-4-yl)methanone |
| SMILES | CCOc1ccccc1C(=O)N1CC(C)=NN2C(C)=C(C)C(C)=NC2C1 |
| InChI | InChI=1S/C20H26N4O2/c1-6-26-18-10-8-7-9-17(18)20(25)23-11-13(2)22-24-16(5)14(3)15(4)21-19(24)12-23/h7-10,19H,6,11-12H2,1-5H3 |
| InChIKey | VGXWTJXDYZEYCD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |