C26H26FNO3 — CID 67405945
(2-ethoxyphenyl)-[3-[[4-(4-fluorophenyl)phenoxy]methyl]pyrrolidin-1-yl]methanone (PubChem CID 67405945) has the molecular formula C26H26FNO3 and a molecular weight of 419.50 g/mol. Its IUPAC name is (2-ethoxyphenyl)-[3-[[4-(4-fluorophenyl)phenoxy]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | (2-ethoxyphenyl)-[3-[[4-(4-fluorophenyl)phenoxy]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 67405945 |
| Molecular Formula | C26H26FNO3 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (2-ethoxyphenyl)-[3-[[4-(4-fluorophenyl)phenoxy]methyl]pyrrolidin-1-yl]methanone |
| SMILES | CCOc1ccccc1C(=O)N1CCC(COc2ccc(-c3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C26H26FNO3/c1-2-30-25-6-4-3-5-24(25)26(29)28-16-15-19(17-28)18-31-23-13-9-21(10-14-23)20-7-11-22(27)12-8-20/h3-14,19H,2,15-18H2,1H3 |
| InChIKey | SPGRAKVCCXYSGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |