C17H30N2 — CID 123549512
N,N,2-trimethyl-N'-(3,6,7-trimethylocta-5,7-dien-2-yl)prop-2-enimidamide (PubChem CID 123549512) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is N,N,2-trimethyl-N'-(3,6,7-trimethylocta-5,7-dien-2-yl)prop-2-enimidamide.
| Compound Name | N,N,2-trimethyl-N'-(3,6,7-trimethylocta-5,7-dien-2-yl)prop-2-enimidamide |
|---|---|
| PubChem CID | 123549512 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | N,N,2-trimethyl-N'-(3,6,7-trimethylocta-5,7-dien-2-yl)prop-2-enimidamide |
| SMILES | C=C(C)C(C)=CCC(C)C(C)/N=C(\C(=C)C)N(C)C |
| InChI | InChI=1S/C17H30N2/c1-12(2)14(5)10-11-15(6)16(7)18-17(13(3)4)19(8)9/h10,15-16H,1,3,11H2,2,4-9H3/b14-10?,18-17+ |
| InChIKey | XFVRDUGIIKJOPJ-OBKAZCLXSA-N |
| XLogP | 4.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|