C34H62O12 — CID 123549682
bis[2-[2-methyl-1-oxo-1-(2-propan-2-yloxypropoxy)propan-2-yl]oxypropyl] 2,2,4-trimethylpentanedioate (PubChem CID 123549682) has the molecular formula C34H62O12 and a molecular weight of 662.86 g/mol. Its IUPAC name is bis[2-[2-methyl-1-oxo-1-(2-propan-2-yloxypropoxy)propan-2-yl]oxypropyl] 2,2,4-trimethylpentanedioate.
| Compound Name | bis[2-[2-methyl-1-oxo-1-(2-propan-2-yloxypropoxy)propan-2-yl]oxypropyl] 2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 123549682 |
| Molecular Formula | C34H62O12 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.42 |
| IUPAC Name | bis[2-[2-methyl-1-oxo-1-(2-propan-2-yloxypropoxy)propan-2-yl]oxypropyl] 2,2,4-trimethylpentanedioate |
| SMILES | CC(C)OC(C)COC(=O)C(C)(C)OC(C)COC(=O)C(C)CC(C)(C)C(=O)OCC(C)OC(C)(C)C(=O)OCC(C)OC(C)C |
| InChI | InChI=1S/C34H62O12/c1-21(2)43-24(6)17-41-30(37)33(12,13)45-26(8)19-39-28(35)23(5)16-32(10,11)29(36)40-20-27(9)46-34(14,15)31(38)42-18-25(7)44-22(3)4/h21-27H,16-20H2,1-15H3 |
| InChIKey | GDPUJWRFVGHGMJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|