C35H35N5O — CID 123553616
N-[3-[4-amino-3-[1-(4-pyridin-3-yl-1H-benzimidazol-2-yl)prop-1-enyl]phenyl]-5-ethylphenyl]cyclopentanecarboxamide (PubChem CID 123553616) has the molecular formula C35H35N5O and a molecular weight of 541.70 g/mol. Its IUPAC name is N-[3-[4-amino-3-[1-(4-pyridin-3-yl-1H-benzimidazol-2-yl)prop-1-enyl]phenyl]-5-ethylphenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[4-amino-3-[1-(4-pyridin-3-yl-1H-benzimidazol-2-yl)prop-1-enyl]phenyl]-5-ethylphenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 123553616 |
| Molecular Formula | C35H35N5O |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | N-[3-[4-amino-3-[1-(4-pyridin-3-yl-1H-benzimidazol-2-yl)prop-1-enyl]phenyl]-5-ethylphenyl]cyclopentanecarboxamide |
| SMILES | CC=C(c1nc2c(-c3cccnc3)cccc2[nH]1)c1cc(-c2cc(CC)cc(NC(=O)C3CCCC3)c2)ccc1N |
| InChI | InChI=1S/C35H35N5O/c1-3-22-17-26(19-27(18-22)38-35(41)23-9-5-6-10-23)24-14-15-31(36)30(20-24)28(4-2)34-39-32-13-7-12-29(33(32)40-34)25-11-8-16-37-21-25/h4,7-8,11-21,23H,3,5-6,9-10,36H2,1-2H3,(H,38,41)(H,39,40) |
| InChIKey | IXALCJWMFDBIRW-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|