C31H30N6O — CID 137037803
N-[3-[4-amino-3-(4-pyridin-2-yl-1H-benzimidazole-2-carboximidoyl)phenyl]-5-ethylphenyl]butanamide (PubChem CID 137037803) has the molecular formula C31H30N6O and a molecular weight of 502.62 g/mol. Its IUPAC name is N-[3-[4-amino-3-(4-pyridin-2-yl-1H-benzimidazole-2-carboximidoyl)phenyl]-5-ethylphenyl]butanamide.
| Compound Name | N-[3-[4-amino-3-(4-pyridin-2-yl-1H-benzimidazole-2-carboximidoyl)phenyl]-5-ethylphenyl]butanamide |
|---|---|
| PubChem CID | 137037803 |
| Molecular Formula | C31H30N6O |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | N-[3-[4-amino-3-(4-pyridin-2-yl-1H-benzimidazole-2-carboximidoyl)phenyl]-5-ethylphenyl]butanamide |
| SMILES | [H]/N=C(/c1nc2c(-c3ccccn3)cccc2[nH]1)c1cc(-c2cc(CC)cc(NC(=O)CCC)c2)ccc1N |
| InChI | InChI=1S/C31H30N6O/c1-3-8-28(38)35-22-16-19(4-2)15-21(17-22)20-12-13-25(32)24(18-20)29(33)31-36-27-11-7-9-23(30(27)37-31)26-10-5-6-14-34-26/h5-7,9-18,33H,3-4,8,32H2,1-2H3,(H,35,38)(H,36,37)/b33-29+ |
| InChIKey | WPVRHKJJDHLASU-XPXRSFDGSA-N |
| XLogP | 6.59 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|