C20H16N4O — CID 142077054
3-[4-amino-3-(1H-benzimidazole-2-carboximidoyl)phenyl]phenol (PubChem CID 142077054) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-[4-amino-3-(1H-benzimidazole-2-carboximidoyl)phenyl]phenol.
| Compound Name | 3-[4-amino-3-(1H-benzimidazole-2-carboximidoyl)phenyl]phenol |
|---|---|
| PubChem CID | 142077054 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-[4-amino-3-(1H-benzimidazole-2-carboximidoyl)phenyl]phenol |
| SMILES | [H]/N=C(\c1nc2ccccc2[nH]1)c1cc(-c2cccc(O)c2)ccc1N |
| InChI | InChI=1S/C20H16N4O/c21-16-9-8-13(12-4-3-5-14(25)10-12)11-15(16)19(22)20-23-17-6-1-2-7-18(17)24-20/h1-11,22,25H,21H2,(H,23,24)/b22-19- |
| InChIKey | GMLSJLZZIPZVPX-QOCHGBHMSA-N |
| XLogP | 3.93 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|