C17H12N5O — CID 59472192
CID 59472192 (PubChem CID 59472192) has the molecular formula C17H12N5O and a molecular weight of 302.32 g/mol.
| Compound Name | CID 59472192 |
|---|---|
| PubChem CID | 59472192 |
| Molecular Formula | C17H12N5O |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | — |
| SMILES | [NH]c1ncc(-c2cccc(O)c2)nc1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H12N5O/c18-16-15(17-21-12-6-1-2-7-13(12)22-17)20-14(9-19-16)10-4-3-5-11(23)8-10/h1-9,18,23H,(H,21,22) |
| InChIKey | WSMDPUFFYOGSSC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |