C26H24N6 — CID 137037023
4-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)-2-[4-(4-methylimidazol-1-yl)-1H-benzimidazole-2-carboximidoyl]aniline (PubChem CID 137037023) has the molecular formula C26H24N6 and a molecular weight of 420.52 g/mol. Its IUPAC name is 4-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)-2-[4-(4-methylimidazol-1-yl)-1H-benzimidazole-2-carboximidoyl]aniline.
| Compound Name | 4-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)-2-[4-(4-methylimidazol-1-yl)-1H-benzimidazole-2-carboximidoyl]aniline |
|---|---|
| PubChem CID | 137037023 |
| Molecular Formula | C26H24N6 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-(7-methyl-3-bicyclo[4.1.0]hepta-2,4-dienyl)-2-[4-(4-methylimidazol-1-yl)-1H-benzimidazole-2-carboximidoyl]aniline |
| SMILES | [H]/N=C(\c1nc2c(-n3cnc(C)c3)cccc2[nH]1)c1cc(C2=CC3C(C)C3C=C2)ccc1N |
| InChI | InChI=1S/C26H24N6/c1-14-12-32(13-29-14)23-5-3-4-22-25(23)31-26(30-22)24(28)20-11-17(7-9-21(20)27)16-6-8-18-15(2)19(18)10-16/h3-13,15,18-19,28H,27H2,1-2H3,(H,30,31)/b28-24- |
| InChIKey | PVEOOCSOCJNNQW-COOPMVRXSA-N |
| XLogP | 4.89 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|