C35H37N5O — CID 137050052
N-[3-[4-amino-3-(3-ethyl-4-pyridin-2-yl-1H-indole-2-carboximidoyl)phenyl]-5-ethylphenyl]pentanamide (PubChem CID 137050052) has the molecular formula C35H37N5O and a molecular weight of 543.72 g/mol. Its IUPAC name is N-[3-[4-amino-3-(3-ethyl-4-pyridin-2-yl-1H-indole-2-carboximidoyl)phenyl]-5-ethylphenyl]pentanamide.
| Compound Name | N-[3-[4-amino-3-(3-ethyl-4-pyridin-2-yl-1H-indole-2-carboximidoyl)phenyl]-5-ethylphenyl]pentanamide |
|---|---|
| PubChem CID | 137050052 |
| Molecular Formula | C35H37N5O |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.30 |
| IUPAC Name | N-[3-[4-amino-3-(3-ethyl-4-pyridin-2-yl-1H-indole-2-carboximidoyl)phenyl]-5-ethylphenyl]pentanamide |
| SMILES | [H]/N=C(\c1cc(-c2cc(CC)cc(NC(=O)CCCC)c2)ccc1N)c1[nH]c2cccc(-c3ccccn3)c2c1CC |
| InChI | InChI=1S/C35H37N5O/c1-4-7-14-32(41)39-25-19-22(5-2)18-24(20-25)23-15-16-29(36)28(21-23)34(37)35-26(6-3)33-27(11-10-13-31(33)40-35)30-12-8-9-17-38-30/h8-13,15-21,37,40H,4-7,14,36H2,1-3H3,(H,39,41)/b37-34+ |
| InChIKey | OQHIQTYSDFRHRP-NFSLGCCLSA-N |
| XLogP | 8.15 |
| TPSA | 107.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|