C13H22O3 — CID 123553830
(2-methyl-4-oxopentan-3-yl) 2,2-dimethylpent-4-enoate (PubChem CID 123553830) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (2-methyl-4-oxopentan-3-yl) 2,2-dimethylpent-4-enoate.
| Compound Name | (2-methyl-4-oxopentan-3-yl) 2,2-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 123553830 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (2-methyl-4-oxopentan-3-yl) 2,2-dimethylpent-4-enoate |
| SMILES | C=CCC(C)(C)C(=O)OC(C(C)=O)C(C)C |
| InChI | InChI=1S/C13H22O3/c1-7-8-13(5,6)12(15)16-11(9(2)3)10(4)14/h7,9,11H,1,8H2,2-6H3 |
| InChIKey | NLNYMQQDXJXZPH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|