C27H26F4N4O4 — CID 123556632
N-[5-[[[6-(3-fluorophenyl)-3-pyridinyl]-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]-2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propanamide (PubChem CID 123556632) has the molecular formula C27H26F4N4O4 and a molecular weight of 546.52 g/mol. Its IUPAC name is N-[5-[[[6-(3-fluorophenyl)-3-pyridinyl]-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]-2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propanamide.
| Compound Name | N-[5-[[[6-(3-fluorophenyl)-3-pyridinyl]-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]-2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propanamide |
|---|---|
| PubChem CID | 123556632 |
| Molecular Formula | C27H26F4N4O4 |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N-[5-[[[6-(3-fluorophenyl)-3-pyridinyl]-hydroxymethyl]amino]-2-(trifluoromethoxy)phenyl]-2-(2-oxa-5-azabicyclo[2.2.1]heptan-5-yl)propanamide |
| SMILES | CC(C(=O)Nc1cc(NC(O)c2ccc(-c3cccc(F)c3)nc2)ccc1OC(F)(F)F)N1CC2CC1CO2 |
| InChI | InChI=1S/C27H26F4N4O4/c1-15(35-13-21-11-20(35)14-38-21)25(36)34-23-10-19(6-8-24(23)39-27(29,30)31)33-26(37)17-5-7-22(32-12-17)16-3-2-4-18(28)9-16/h2-10,12,15,20-21,26,33,37H,11,13-14H2,1H3,(H,34,36) |
| InChIKey | AHCOBDLLNZSDMZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 95.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|