C19H28N4O — CID 123556874
2-ethyl-5-methyl-N-[3-(methylamino)-4-phenylpentyl]pyrazole-3-carboxamide (PubChem CID 123556874) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-ethyl-5-methyl-N-[3-(methylamino)-4-phenylpentyl]pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-5-methyl-N-[3-(methylamino)-4-phenylpentyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 123556874 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | 2-ethyl-5-methyl-N-[3-(methylamino)-4-phenylpentyl]pyrazole-3-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)NCCC(NC)C(C)c1ccccc1 |
| InChI | InChI=1S/C19H28N4O/c1-5-23-18(13-14(2)22-23)19(24)21-12-11-17(20-4)15(3)16-9-7-6-8-10-16/h6-10,13,15,17,20H,5,11-12H2,1-4H3,(H,21,24) |
| InChIKey | VZWOGJQBSYLQDC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |