C23H32FN4O8P — CID 123557433
propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-4-fluoro-3,5-dihydroxypentoxy]-phenoxyphosphoryl]amino]propanoate (PubChem CID 123557433) has the molecular formula C23H32FN4O8P and a molecular weight of 542.50 g/mol. Its IUPAC name is propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-4-fluoro-3,5-dihydroxypentoxy]-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-4-fluoro-3,5-dihydroxypentoxy]-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 123557433 |
| Molecular Formula | C23H32FN4O8P |
| Molecular Weight | 542.50 g/mol |
| Exact Mass | 542.19 |
| IUPAC Name | propan-2-yl 2-[[[5-(4-amino-2-oxopyrimidin-1-yl)-2-ethenyl-4-fluoro-3,5-dihydroxypentoxy]-phenoxyphosphoryl]amino]propanoate |
| SMILES | C=CC(COP(=O)(NC(C)C(=O)OC(C)C)Oc1ccccc1)C(O)C(F)C(O)n1ccc(N)nc1=O |
| InChI | InChI=1S/C23H32FN4O8P/c1-5-16(20(29)19(24)21(30)28-12-11-18(25)26-23(28)32)13-34-37(33,36-17-9-7-6-8-10-17)27-15(4)22(31)35-14(2)3/h5-12,14-16,19-21,29-30H,1,13H2,2-4H3,(H,27,33)(H2,25,26,32) |
| InChIKey | AVAHFDYDEKXECJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 175.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|