C32H34F6N4O5S — CID 123557862
8-[2-[4-[4-(fluoromethyl)-4-hydroxypiperidine-1-carbonyl]-2,6-dimethylphenyl]ethenylsulfonyl]-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 123557862) has the molecular formula C32H34F6N4O5S and a molecular weight of 700.70 g/mol. Its IUPAC name is 8-[2-[4-[4-(fluoromethyl)-4-hydroxypiperidine-1-carbonyl]-2,6-dimethylphenyl]ethenylsulfonyl]-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-[2-[4-[4-(fluoromethyl)-4-hydroxypiperidine-1-carbonyl]-2,6-dimethylphenyl]ethenylsulfonyl]-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 123557862 |
| Molecular Formula | C32H34F6N4O5S |
| Molecular Weight | 700.70 g/mol |
| Exact Mass | 700.22 |
| IUPAC Name | 8-[2-[4-[4-(fluoromethyl)-4-hydroxypiperidine-1-carbonyl]-2,6-dimethylphenyl]ethenylsulfonyl]-2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | Cc1cc(C(=O)N2CCC(O)(CF)CC2)cc(C)c1C=CS(=O)(=O)N1CCC2(CC1)N=C(c1cccc(C(F)(F)C(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C32H34F6N4O5S/c1-20-16-23(27(43)41-11-7-29(45,19-33)8-12-41)17-21(2)25(20)6-15-48(46,47)42-13-9-30(10-14-42)28(44)39-26(40-30)22-4-3-5-24(18-22)31(34,35)32(36,37)38/h3-6,15-18,45H,7-14,19H2,1-2H3,(H,39,40,44) |
| InChIKey | QVLLLFKJAZCPCV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|