C29H28F9N5O4S — CID 123917604
1-[3,5-dimethyl-4-[2-[[2-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea (PubChem CID 123917604) has the molecular formula C29H28F9N5O4S and a molecular weight of 713.62 g/mol. Its IUPAC name is 1-[3,5-dimethyl-4-[2-[[2-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea.
| Compound Name | 1-[3,5-dimethyl-4-[2-[[2-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea |
|---|---|
| PubChem CID | 123917604 |
| Molecular Formula | C29H28F9N5O4S |
| Molecular Weight | 713.62 g/mol |
| Exact Mass | 713.17 |
| IUPAC Name | 1-[3,5-dimethyl-4-[2-[[2-[3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)phenyl]-4-oxo-1,3,8-triazaspiro[4.5]dec-1-en-8-yl]sulfonyl]ethenyl]phenyl]-1-methylurea |
| SMILES | Cc1cc(N(C)C(N)=O)cc(C)c1C=CS(=O)(=O)N1CCC2(CC1)N=C(c1cccc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1)NC2=O |
| InChI | InChI=1S/C29H28F9N5O4S/c1-16-13-20(42(3)24(39)45)14-17(2)21(16)7-12-48(46,47)43-10-8-25(9-11-43)23(44)40-22(41-25)18-5-4-6-19(15-18)26(30,31)27(32,33)28(34,35)29(36,37)38/h4-7,12-15H,8-11H2,1-3H3,(H2,39,45)(H,40,41,44) |
| InChIKey | HBCYWIOOHOYCFH-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 125.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|